C17H20N2O4S — CID 119220256
6-[[2-(4-methoxyphenyl)-1,3-thiazole-5-carbonyl]amino]hexanoic acid (PubChem CID 119220256) has the molecular formula C17H20N2O4S and a molecular weight of 348.42 g/mol. Its IUPAC name is 6-[[2-(4-methoxyphenyl)-1,3-thiazole-5-carbonyl]amino]hexanoic acid.
| Compound Name | 6-[[2-(4-methoxyphenyl)-1,3-thiazole-5-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 119220256 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 6-[[2-(4-methoxyphenyl)-1,3-thiazole-5-carbonyl]amino]hexanoic acid |
| SMILES | COc1ccc(-c2ncc(C(=O)NCCCCCC(=O)O)s2)cc1 |
| InChI | InChI=1S/C17H20N2O4S/c1-23-13-8-6-12(7-9-13)17-19-11-14(24-17)16(22)18-10-4-2-3-5-15(20)21/h6-9,11H,2-5,10H2,1H3,(H,18,22)(H,20,21) |
| InChIKey | SDYXXAGEHIRCGD-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|