C17H19F2N3O3S — CID 166627873
2-(3,5-difluorophenyl)-N-[7-(hydroxyamino)-7-oxoheptyl]-1,3-thiazole-5-carboxamide (PubChem CID 166627873) has the molecular formula C17H19F2N3O3S and a molecular weight of 383.42 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-N-[7-(hydroxyamino)-7-oxoheptyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(3,5-difluorophenyl)-N-[7-(hydroxyamino)-7-oxoheptyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 166627873 |
| Molecular Formula | C17H19F2N3O3S |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 2-(3,5-difluorophenyl)-N-[7-(hydroxyamino)-7-oxoheptyl]-1,3-thiazole-5-carboxamide |
| SMILES | O=C(CCCCCCNC(=O)c1cnc(-c2cc(F)cc(F)c2)s1)NO |
| InChI | InChI=1S/C17H19F2N3O3S/c18-12-7-11(8-13(19)9-12)17-21-10-14(26-17)16(24)20-6-4-2-1-3-5-15(23)22-25/h7-10,25H,1-6H2,(H,20,24)(H,22,23) |
| InChIKey | DQWPXWKJZMUQCX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|