C14H15N3O3S3 — CID 167987437
3-[2-[(2-pyridin-3-yl-1,3-thiazole-5-carbonyl)amino]ethyldisulfanyl]propanoic acid (PubChem CID 167987437) has the molecular formula C14H15N3O3S3 and a molecular weight of 369.49 g/mol. Its IUPAC name is 3-[2-[(2-pyridin-3-yl-1,3-thiazole-5-carbonyl)amino]ethyldisulfanyl]propanoic acid.
| Compound Name | 3-[2-[(2-pyridin-3-yl-1,3-thiazole-5-carbonyl)amino]ethyldisulfanyl]propanoic acid |
|---|---|
| PubChem CID | 167987437 |
| Molecular Formula | C14H15N3O3S3 |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | 3-[2-[(2-pyridin-3-yl-1,3-thiazole-5-carbonyl)amino]ethyldisulfanyl]propanoic acid |
| SMILES | O=C(O)CCSSCCNC(=O)c1cnc(-c2cccnc2)s1 |
| InChI | InChI=1S/C14H15N3O3S3/c18-12(19)3-6-21-22-7-5-16-13(20)11-9-17-14(23-11)10-2-1-4-15-8-10/h1-2,4,8-9H,3,5-7H2,(H,16,20)(H,18,19) |
| InChIKey | WBQXWJFKTDRDTM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|