C12H13N3O2S — CID 58236291
N-ethyl-N-methoxy-2-pyridin-3-yl-1,3-thiazole-5-carboxamide (PubChem CID 58236291) has the molecular formula C12H13N3O2S and a molecular weight of 263.32 g/mol. Its IUPAC name is N-ethyl-N-methoxy-2-pyridin-3-yl-1,3-thiazole-5-carboxamide.
| Compound Name | N-ethyl-N-methoxy-2-pyridin-3-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 58236291 |
| Molecular Formula | C12H13N3O2S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | N-ethyl-N-methoxy-2-pyridin-3-yl-1,3-thiazole-5-carboxamide |
| SMILES | CCN(OC)C(=O)c1cnc(-c2cccnc2)s1 |
| InChI | InChI=1S/C12H13N3O2S/c1-3-15(17-2)12(16)10-8-14-11(18-10)9-5-4-6-13-7-9/h4-8H,3H2,1-2H3 |
| InChIKey | NXSZMOLLDZCEJB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|