C10H8N2OS — CID 115091325
2-(2-pyridin-3-yl-1,3-thiazol-5-yl)acetaldehyde (PubChem CID 115091325) has the molecular formula C10H8N2OS and a molecular weight of 204.25 g/mol. Its IUPAC name is 2-(2-pyridin-3-yl-1,3-thiazol-5-yl)acetaldehyde.
| Compound Name | 2-(2-pyridin-3-yl-1,3-thiazol-5-yl)acetaldehyde |
|---|---|
| PubChem CID | 115091325 |
| Molecular Formula | C10H8N2OS |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.04 |
| IUPAC Name | 2-(2-pyridin-3-yl-1,3-thiazol-5-yl)acetaldehyde |
| SMILES | O=CCc1cnc(-c2cccnc2)s1 |
| InChI | InChI=1S/C10H8N2OS/c13-5-3-9-7-12-10(14-9)8-2-1-4-11-6-8/h1-2,4-7H,3H2 |
| InChIKey | CAQJAKWCHXVOMS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|