C9H7N3OS — CID 174849944
N-(2-pyridin-3-yl-1,3-thiazol-5-yl)formamide (PubChem CID 174849944) has the molecular formula C9H7N3OS and a molecular weight of 205.24 g/mol. Its IUPAC name is N-(2-pyridin-3-yl-1,3-thiazol-5-yl)formamide.
| Compound Name | N-(2-pyridin-3-yl-1,3-thiazol-5-yl)formamide |
|---|---|
| PubChem CID | 174849944 |
| Molecular Formula | C9H7N3OS |
| Molecular Weight | 205.24 g/mol |
| Exact Mass | 205.03 |
| IUPAC Name | N-(2-pyridin-3-yl-1,3-thiazol-5-yl)formamide |
| SMILES | O=CNc1cnc(-c2cccnc2)s1 |
| InChI | InChI=1S/C9H7N3OS/c13-6-12-8-5-11-9(14-8)7-2-1-3-10-4-7/h1-6H,(H,12,13) |
| InChIKey | UWGGFVQQSZGOOJ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.24 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|