C12H14N2S — CID 67548098
5-butyl-2-pyridin-3-yl-1,3-thiazole (PubChem CID 67548098) has the molecular formula C12H14N2S and a molecular weight of 218.33 g/mol. Its IUPAC name is 5-butyl-2-pyridin-3-yl-1,3-thiazole.
| Compound Name | 5-butyl-2-pyridin-3-yl-1,3-thiazole |
|---|---|
| PubChem CID | 67548098 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.33 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 5-butyl-2-pyridin-3-yl-1,3-thiazole |
| SMILES | CCCCc1cnc(-c2cccnc2)s1 |
| InChI | InChI=1S/C12H14N2S/c1-2-3-6-11-9-14-12(15-11)10-5-4-7-13-8-10/h4-5,7-9H,2-3,6H2,1H3 |
| InChIKey | WSLQNUNLIVUSQU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |