C8H5ClN2S — CID 117259093
5-chloro-2-pyridin-3-yl-1,3-thiazole (PubChem CID 117259093) has the molecular formula C8H5ClN2S and a molecular weight of 196.66 g/mol. Its IUPAC name is 5-chloro-2-pyridin-3-yl-1,3-thiazole.
| Compound Name | 5-chloro-2-pyridin-3-yl-1,3-thiazole |
|---|---|
| PubChem CID | 117259093 |
| Molecular Formula | C8H5ClN2S |
| Molecular Weight | 196.66 g/mol |
| Exact Mass | 195.99 |
| IUPAC Name | 5-chloro-2-pyridin-3-yl-1,3-thiazole |
| SMILES | Clc1cnc(-c2cccnc2)s1 |
| InChI | InChI=1S/C8H5ClN2S/c9-7-5-11-8(12-7)6-2-1-3-10-4-6/h1-5H |
| InChIKey | VQHNXOTXVXSOIE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.66 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |