C9H4Cl2N2OS — CID 86713748
4-chloro-2-pyridin-3-yl-1,3-thiazole-5-carbonyl chloride (PubChem CID 86713748) has the molecular formula C9H4Cl2N2OS and a molecular weight of 259.12 g/mol. Its IUPAC name is 4-chloro-2-pyridin-3-yl-1,3-thiazole-5-carbonyl chloride.
| Compound Name | 4-chloro-2-pyridin-3-yl-1,3-thiazole-5-carbonyl chloride |
|---|---|
| PubChem CID | 86713748 |
| Molecular Formula | C9H4Cl2N2OS |
| Molecular Weight | 259.12 g/mol |
| Exact Mass | 257.94 |
| IUPAC Name | 4-chloro-2-pyridin-3-yl-1,3-thiazole-5-carbonyl chloride |
| SMILES | O=C(Cl)c1sc(-c2cccnc2)nc1Cl |
| InChI | InChI=1S/C9H4Cl2N2OS/c10-7-6(8(11)14)15-9(13-7)5-2-1-3-12-4-5/h1-4H |
| InChIKey | QYAOZJKVIRNTCN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.12 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|