C11H10ClN3OS2 — CID 89012295
N-(4-chloro-2-pyridin-3-yl-1,3-thiazol-5-yl)-N-methyl-2-sulfanylacetamide (PubChem CID 89012295) has the molecular formula C11H10ClN3OS2 and a molecular weight of 299.81 g/mol. Its IUPAC name is N-(4-chloro-2-pyridin-3-yl-1,3-thiazol-5-yl)-N-methyl-2-sulfanylacetamide.
| Compound Name | N-(4-chloro-2-pyridin-3-yl-1,3-thiazol-5-yl)-N-methyl-2-sulfanylacetamide |
|---|---|
| PubChem CID | 89012295 |
| Molecular Formula | C11H10ClN3OS2 |
| Molecular Weight | 299.81 g/mol |
| Exact Mass | 299.00 |
| IUPAC Name | N-(4-chloro-2-pyridin-3-yl-1,3-thiazol-5-yl)-N-methyl-2-sulfanylacetamide |
| SMILES | CN(C(=O)CS)c1sc(-c2cccnc2)nc1Cl |
| InChI | InChI=1S/C11H10ClN3OS2/c1-15(8(16)6-17)11-9(12)14-10(18-11)7-3-2-4-13-5-7/h2-5,17H,6H2,1H3 |
| InChIKey | UXVFLFCWVBPGEM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.81 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|