C11H10ClN3S2 — CID 89394604
4-chloro-N,N-dimethyl-2-pyridin-3-yl-1,3-thiazole-5-carbothioamide (PubChem CID 89394604) has the molecular formula C11H10ClN3S2 and a molecular weight of 283.81 g/mol. Its IUPAC name is 4-chloro-N,N-dimethyl-2-pyridin-3-yl-1,3-thiazole-5-carbothioamide.
| Compound Name | 4-chloro-N,N-dimethyl-2-pyridin-3-yl-1,3-thiazole-5-carbothioamide |
|---|---|
| PubChem CID | 89394604 |
| Molecular Formula | C11H10ClN3S2 |
| Molecular Weight | 283.81 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | 4-chloro-N,N-dimethyl-2-pyridin-3-yl-1,3-thiazole-5-carbothioamide |
| SMILES | CN(C)C(=S)c1sc(-c2cccnc2)nc1Cl |
| InChI | InChI=1S/C11H10ClN3S2/c1-15(2)11(16)8-9(12)14-10(17-8)7-4-3-5-13-6-7/h3-6H,1-2H3 |
| InChIKey | IJGINBXZUDKDCH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.81 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|