C16H11ClF3N5O3S — CID 123774821
1-(4-chloro-2-pyridin-3-yl-1,3-thiazol-5-yl)-N-(4,6-dimethoxypyrimidin-2-yl)oxy-2,2,2-trifluoroethanimine (PubChem CID 123774821) has the molecular formula C16H11ClF3N5O3S and a molecular weight of 445.81 g/mol. Its IUPAC name is 1-(4-chloro-2-pyridin-3-yl-1,3-thiazol-5-yl)-N-(4,6-dimethoxypyrimidin-2-yl)oxy-2,2,2-trifluoroethanimine.
| Compound Name | 1-(4-chloro-2-pyridin-3-yl-1,3-thiazol-5-yl)-N-(4,6-dimethoxypyrimidin-2-yl)oxy-2,2,2-trifluoroethanimine |
|---|---|
| PubChem CID | 123774821 |
| Molecular Formula | C16H11ClF3N5O3S |
| Molecular Weight | 445.81 g/mol |
| Exact Mass | 445.02 |
| IUPAC Name | 1-(4-chloro-2-pyridin-3-yl-1,3-thiazol-5-yl)-N-(4,6-dimethoxypyrimidin-2-yl)oxy-2,2,2-trifluoroethanimine |
| SMILES | COc1cc(OC)nc(ON=C(c2sc(-c3cccnc3)nc2Cl)C(F)(F)F)n1 |
| InChI | InChI=1S/C16H11ClF3N5O3S/c1-26-9-6-10(27-2)23-15(22-9)28-25-12(16(18,19)20)11-13(17)24-14(29-11)8-4-3-5-21-7-8/h3-7H,1-2H3 |
| InChIKey | HMXOUGCAXFTQDM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 91.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.81 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|