C17H19N7O2S — CID 89348710
6-ethoxy-2-[(E)-1-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)ethylideneamino]oxypyrimidine-4,5-diamine (PubChem CID 89348710) has the molecular formula C17H19N7O2S and a molecular weight of 385.45 g/mol. Its IUPAC name is 6-ethoxy-2-[(E)-1-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)ethylideneamino]oxypyrimidine-4,5-diamine.
| Compound Name | 6-ethoxy-2-[(E)-1-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)ethylideneamino]oxypyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 89348710 |
| Molecular Formula | C17H19N7O2S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 6-ethoxy-2-[(E)-1-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)ethylideneamino]oxypyrimidine-4,5-diamine |
| SMILES | CCOc1nc(O/N=C(\C)c2sc(-c3cccnc3)nc2C)nc(N)c1N |
| InChI | InChI=1S/C17H19N7O2S/c1-4-25-15-12(18)14(19)22-17(23-15)26-24-10(3)13-9(2)21-16(27-13)11-6-5-7-20-8-11/h5-8H,4,18H2,1-3H3,(H2,19,22,23)/b24-10+ |
| InChIKey | TYQSYJWSOKIGEO-YSURURNPSA-N |
| XLogP | 2.67 |
| TPSA | 134.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|