C17H13N5OS — CID 123186441
6-[1-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)ethylideneamino]oxypyridine-3-carbonitrile (PubChem CID 123186441) has the molecular formula C17H13N5OS and a molecular weight of 335.39 g/mol. Its IUPAC name is 6-[1-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)ethylideneamino]oxypyridine-3-carbonitrile.
| Compound Name | 6-[1-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)ethylideneamino]oxypyridine-3-carbonitrile |
|---|---|
| PubChem CID | 123186441 |
| Molecular Formula | C17H13N5OS |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 6-[1-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)ethylideneamino]oxypyridine-3-carbonitrile |
| SMILES | CC(=NOc1ccc(C#N)cn1)c1sc(-c2cccnc2)nc1C |
| InChI | InChI=1S/C17H13N5OS/c1-11-16(24-17(21-11)14-4-3-7-19-10-14)12(2)22-23-15-6-5-13(8-18)9-20-15/h3-7,9-10H,1-2H3 |
| InChIKey | RQLAFYMGIATDRC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 84.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|