C10H11N3S — CID 59580850
N,4-dimethyl-2-pyridin-3-yl-1,3-thiazol-5-amine (PubChem CID 59580850) has the molecular formula C10H11N3S and a molecular weight of 205.29 g/mol. Its IUPAC name is N,4-dimethyl-2-pyridin-3-yl-1,3-thiazol-5-amine.
| Compound Name | N,4-dimethyl-2-pyridin-3-yl-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 59580850 |
| Molecular Formula | C10H11N3S |
| Molecular Weight | 205.29 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | N,4-dimethyl-2-pyridin-3-yl-1,3-thiazol-5-amine |
| SMILES | CNc1sc(-c2cccnc2)nc1C |
| InChI | InChI=1S/C10H11N3S/c1-7-9(11-2)14-10(13-7)8-4-3-5-12-6-8/h3-6,11H,1-2H3 |
| InChIKey | PDTSCFPOARYQCU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |