C14H14N4O2S — CID 126635303
1-formyl-N-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)azetidine-2-carboxamide (PubChem CID 126635303) has the molecular formula C14H14N4O2S and a molecular weight of 302.36 g/mol. Its IUPAC name is 1-formyl-N-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)azetidine-2-carboxamide.
| Compound Name | 1-formyl-N-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)azetidine-2-carboxamide |
|---|---|
| PubChem CID | 126635303 |
| Molecular Formula | C14H14N4O2S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 1-formyl-N-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)azetidine-2-carboxamide |
| SMILES | Cc1nc(-c2cccnc2)sc1NC(=O)C1CCN1C=O |
| InChI | InChI=1S/C14H14N4O2S/c1-9-13(17-12(20)11-4-6-18(11)8-19)21-14(16-9)10-3-2-5-15-7-10/h2-3,5,7-8,11H,4,6H2,1H3,(H,17,20) |
| InChIKey | OIDAGEYPYLNEFQ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|