C16H15N7O3S — CID 123399208
6-methyl-2-[1-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)ethylideneamino]oxy-5-nitropyrimidin-4-amine (PubChem CID 123399208) has the molecular formula C16H15N7O3S and a molecular weight of 385.41 g/mol. Its IUPAC name is 6-methyl-2-[1-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)ethylideneamino]oxy-5-nitropyrimidin-4-amine.
| Compound Name | 6-methyl-2-[1-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)ethylideneamino]oxy-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 123399208 |
| Molecular Formula | C16H15N7O3S |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 6-methyl-2-[1-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)ethylideneamino]oxy-5-nitropyrimidin-4-amine |
| SMILES | CC(=NOc1nc(C)c([N+](=O)[O-])c(N)n1)c1sc(-c2cccnc2)nc1C |
| InChI | InChI=1S/C16H15N7O3S/c1-8-12(23(24)25)14(17)21-16(20-8)26-22-10(3)13-9(2)19-15(27-13)11-5-4-6-18-7-11/h4-7H,1-3H3,(H2,17,20,21) |
| InChIKey | BWPYYAWVRJCYGK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 142.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|