C16H14ClN5OS — CID 123527684
N-(4-chloro-6-methylpyrimidin-2-yl)oxy-1-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)ethanimine (PubChem CID 123527684) has the molecular formula C16H14ClN5OS and a molecular weight of 359.84 g/mol. Its IUPAC name is N-(4-chloro-6-methylpyrimidin-2-yl)oxy-1-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)ethanimine.
| Compound Name | N-(4-chloro-6-methylpyrimidin-2-yl)oxy-1-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)ethanimine |
|---|---|
| PubChem CID | 123527684 |
| Molecular Formula | C16H14ClN5OS |
| Molecular Weight | 359.84 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | N-(4-chloro-6-methylpyrimidin-2-yl)oxy-1-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)ethanimine |
| SMILES | CC(=NOc1nc(C)cc(Cl)n1)c1sc(-c2cccnc2)nc1C |
| InChI | InChI=1S/C16H14ClN5OS/c1-9-7-13(17)21-16(19-9)23-22-11(3)14-10(2)20-15(24-14)12-5-4-6-18-8-12/h4-8H,1-3H3 |
| InChIKey | FKBPUROZAPCTTA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 73.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.84 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|