C16H16N6O3S — CID 90440045
(E)-N-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]-1-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)ethanimine (PubChem CID 90440045) has the molecular formula C16H16N6O3S and a molecular weight of 372.41 g/mol. Its IUPAC name is (E)-N-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]-1-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)ethanimine.
| Compound Name | (E)-N-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]-1-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)ethanimine |
|---|---|
| PubChem CID | 90440045 |
| Molecular Formula | C16H16N6O3S |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | (E)-N-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]-1-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)ethanimine |
| SMILES | COc1nc(OC)nc(O/N=C(\C)c2sc(-c3cccnc3)nc2C)n1 |
| InChI | InChI=1S/C16H16N6O3S/c1-9-12(26-13(18-9)11-6-5-7-17-8-11)10(2)22-25-16-20-14(23-3)19-15(21-16)24-4/h5-8H,1-4H3/b22-10+ |
| InChIKey | SPUCDAONRJXRBF-LSHDLFTRSA-N |
| XLogP | 2.52 |
| TPSA | 104.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|