C14H15ClN4O2S — CID 123366475
4-chloro-N-(1-methoxyimino-2-methylpropan-2-yl)-2-pyridin-3-yl-1,3-thiazole-5-carboxamide (PubChem CID 123366475) has the molecular formula C14H15ClN4O2S and a molecular weight of 338.82 g/mol. Its IUPAC name is 4-chloro-N-(1-methoxyimino-2-methylpropan-2-yl)-2-pyridin-3-yl-1,3-thiazole-5-carboxamide.
| Compound Name | 4-chloro-N-(1-methoxyimino-2-methylpropan-2-yl)-2-pyridin-3-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 123366475 |
| Molecular Formula | C14H15ClN4O2S |
| Molecular Weight | 338.82 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 4-chloro-N-(1-methoxyimino-2-methylpropan-2-yl)-2-pyridin-3-yl-1,3-thiazole-5-carboxamide |
| SMILES | CON=CC(C)(C)NC(=O)c1sc(-c2cccnc2)nc1Cl |
| InChI | InChI=1S/C14H15ClN4O2S/c1-14(2,8-17-21-3)19-12(20)10-11(15)18-13(22-10)9-5-4-6-16-7-9/h4-8H,1-3H3,(H,19,20) |
| InChIKey | BSXYBNXPXAGSAM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.82 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|