C9H8N4S — CID 82422642
2-pyridin-3-yl-1,3-thiazole-5-carboximidamide (PubChem CID 82422642) has the molecular formula C9H8N4S and a molecular weight of 204.26 g/mol. Its IUPAC name is 2-pyridin-3-yl-1,3-thiazole-5-carboximidamide.
| Compound Name | 2-pyridin-3-yl-1,3-thiazole-5-carboximidamide |
|---|---|
| PubChem CID | 82422642 |
| Molecular Formula | C9H8N4S |
| Molecular Weight | 204.26 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 2-pyridin-3-yl-1,3-thiazole-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1cnc(-c2cccnc2)s1 |
| InChI | InChI=1S/C9H8N4S/c10-8(11)7-5-13-9(14-7)6-2-1-3-12-4-6/h1-5H,(H3,10,11) |
| InChIKey | MVTXCEYJBJOIPF-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 75.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.26 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|