C19H17N3OS — CID 58192567
4-[3-oxo-3-(2-phenyl-1,3-thiazol-5-yl)propyl]benzenecarboximidamide (PubChem CID 58192567) has the molecular formula C19H17N3OS and a molecular weight of 335.43 g/mol. Its IUPAC name is 4-[3-oxo-3-(2-phenyl-1,3-thiazol-5-yl)propyl]benzenecarboximidamide.
| Compound Name | 4-[3-oxo-3-(2-phenyl-1,3-thiazol-5-yl)propyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 58192567 |
| Molecular Formula | C19H17N3OS |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 4-[3-oxo-3-(2-phenyl-1,3-thiazol-5-yl)propyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CCC(=O)c2cnc(-c3ccccc3)s2)cc1 |
| InChI | InChI=1S/C19H17N3OS/c20-18(21)14-9-6-13(7-10-14)8-11-16(23)17-12-22-19(24-17)15-4-2-1-3-5-15/h1-7,9-10,12H,8,11H2,(H3,20,21) |
| InChIKey | NHZLVOLVDVUCOC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 79.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|