About benzenecarboximidamide;(4-phenylphenyl)methanamine
benzenecarboximidamide;(4-phenylphenyl)methanamine (PubChem CID 145327292) has the molecular formula C20H21N3
and a molecular weight of 303.41 g/mol. Its IUPAC name is benzenecarboximidamide;(4-phenylphenyl)methanamine.
Molecular Properties
| Compound Name | benzenecarboximidamide;(4-phenylphenyl)methanamine |
| PubChem CID | 145327292 |
| Molecular Formula | C20H21N3 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | benzenecarboximidamide;(4-phenylphenyl)methanamine |
| SMILES | NCc1ccc(-c2ccccc2)cc1.[H]/N=C(\N)c1ccccc1 |
| InChI | InChI=1S/C13H13N.C7H8N2/c14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12;8-7(9)6-4-2-1-3-5-6/h1-9H,10,14H2;1-5H,(H3,8,9) |
| InChIKey | PKANEBCRUZSJSV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 75.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze benzenecarboximidamide;(4-phenylphenyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenecarboximidamide;(4-phenylphenyl)methanamine?
The IUPAC name of benzenecarboximidamide;(4-phenylphenyl)methanamine (CID 145327292) is benzenecarboximidamide;(4-phenylphenyl)methanamine.
What is the SMILES notation for benzenecarboximidamide;(4-phenylphenyl)methanamine?
The canonical SMILES for benzenecarboximidamide;(4-phenylphenyl)methanamine is NCc1ccc(-c2ccccc2)cc1.[H]/N=C(\N)c1ccccc1.
What is the InChIKey of benzenecarboximidamide;(4-phenylphenyl)methanamine?
The InChIKey is PKANEBCRUZSJSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N.C7H8N2/c14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12;8-7(9)6-4-2-1-3-5-6/h1-9H,10,14H2;1-5H,(H3,8,9).
What are the key properties of benzenecarboximidamide;(4-phenylphenyl)methanamine?
benzenecarboximidamide;(4-phenylphenyl)methanamine has a molecular weight of 303.41 g/mol, XLogP of 3.78, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzenecarboximidamide;(4-phenylphenyl)methanamine is sourced from PubChem (CID 145327292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).