About benzenecarboximidamide;toluene
benzenecarboximidamide;toluene (PubChem CID 158219006) has the molecular formula C14H16N2
and a molecular weight of 212.30 g/mol. Its IUPAC name is benzenecarboximidamide;toluene.
Molecular Properties
| Compound Name | benzenecarboximidamide;toluene |
| PubChem CID | 158219006 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | benzenecarboximidamide;toluene |
| SMILES | Cc1ccccc1.[H]/N=C(\N)c1ccccc1 |
| InChI | InChI=1S/C7H8N2.C7H8/c8-7(9)6-4-2-1-3-5-6;1-7-5-3-2-4-6-7/h1-5H,(H3,8,9);2-6H,1H3 |
| InChIKey | GDAAMJFYJFVBBU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze benzenecarboximidamide;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenecarboximidamide;toluene?
The IUPAC name of benzenecarboximidamide;toluene (CID 158219006) is benzenecarboximidamide;toluene.
What is the SMILES notation for benzenecarboximidamide;toluene?
The canonical SMILES for benzenecarboximidamide;toluene is Cc1ccccc1.[H]/N=C(\N)c1ccccc1.
What is the InChIKey of benzenecarboximidamide;toluene?
The InChIKey is GDAAMJFYJFVBBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2.C7H8/c8-7(9)6-4-2-1-3-5-6;1-7-5-3-2-4-6-7/h1-5H,(H3,8,9);2-6H,1H3.
What are the key properties of benzenecarboximidamide;toluene?
benzenecarboximidamide;toluene has a molecular weight of 212.30 g/mol, XLogP of 2.97, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzenecarboximidamide;toluene is sourced from PubChem (CID 158219006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).