C37H35N5 — CID 145303404
benzenecarboximidamide;[2-(4,6-diphenylpyrimidin-2-yl)phenyl]methanamine;toluene (PubChem CID 145303404) has the molecular formula C37H35N5 and a molecular weight of 549.72 g/mol. Its IUPAC name is benzenecarboximidamide;[2-(4,6-diphenylpyrimidin-2-yl)phenyl]methanamine;toluene.
| Compound Name | benzenecarboximidamide;[2-(4,6-diphenylpyrimidin-2-yl)phenyl]methanamine;toluene |
|---|---|
| PubChem CID | 145303404 |
| Molecular Formula | C37H35N5 |
| Molecular Weight | 549.72 g/mol |
| Exact Mass | 549.29 |
| IUPAC Name | benzenecarboximidamide;[2-(4,6-diphenylpyrimidin-2-yl)phenyl]methanamine;toluene |
| SMILES | Cc1ccccc1.NCc1ccccc1-c1nc(-c2ccccc2)cc(-c2ccccc2)n1.[H]/N=C(\N)c1ccccc1 |
| InChI | InChI=1S/C23H19N3.C7H8N2.C7H8/c24-16-19-13-7-8-14-20(19)23-25-21(17-9-3-1-4-10-17)15-22(26-23)18-11-5-2-6-12-18;8-7(9)6-4-2-1-3-5-6;1-7-5-3-2-4-6-7/h1-15H,16,24H2;1-5H,(H3,8,9);2-6H,1H3 |
| InChIKey | ZOVRYMUSYJAZNE-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 101.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.72 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|