About benzenecarboximidamide;trimethylsulfanium;chloride
benzenecarboximidamide;trimethylsulfanium;chloride (PubChem CID 158339380) has the molecular formula C10H17ClN2S
and a molecular weight of 232.78 g/mol. Its IUPAC name is benzenecarboximidamide;trimethylsulfanium;chloride.
Molecular Properties
| Compound Name | benzenecarboximidamide;trimethylsulfanium;chloride |
| PubChem CID | 158339380 |
| Molecular Formula | C10H17ClN2S |
| Molecular Weight | 232.78 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | benzenecarboximidamide;trimethylsulfanium;chloride |
| SMILES | C[S+](C)C.[Cl-].[H]/N=C(\N)c1ccccc1 |
| InChI | InChI=1S/C7H8N2.C3H9S.ClH/c8-7(9)6-4-2-1-3-5-6;1-4(2)3;/h1-5H,(H3,8,9);1-3H3;1H/q;+1;/p-1 |
| InChIKey | FPDGGGLICVADQQ-UHFFFAOYSA-M |
| XLogP | -1.53 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.78 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze benzenecarboximidamide;trimethylsulfanium;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenecarboximidamide;trimethylsulfanium;chloride?
The IUPAC name of benzenecarboximidamide;trimethylsulfanium;chloride (CID 158339380) is benzenecarboximidamide;trimethylsulfanium;chloride.
What is the SMILES notation for benzenecarboximidamide;trimethylsulfanium;chloride?
The canonical SMILES for benzenecarboximidamide;trimethylsulfanium;chloride is C[S+](C)C.[Cl-].[H]/N=C(\N)c1ccccc1.
What is the InChIKey of benzenecarboximidamide;trimethylsulfanium;chloride?
The InChIKey is FPDGGGLICVADQQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H8N2.C3H9S.ClH/c8-7(9)6-4-2-1-3-5-6;1-4(2)3;/h1-5H,(H3,8,9);1-3H3;1H/q;+1;/p-1.
What are the key properties of benzenecarboximidamide;trimethylsulfanium;chloride?
benzenecarboximidamide;trimethylsulfanium;chloride has a molecular weight of 232.78 g/mol, XLogP of -1.53, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzenecarboximidamide;trimethylsulfanium;chloride is sourced from PubChem (CID 158339380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).