About benzenecarboximidamide;hydron;chloride
benzenecarboximidamide;hydron;chloride (PubChem CID 66824376) has the molecular formula C7H9ClN2
and a molecular weight of 156.62 g/mol. Its IUPAC name is benzenecarboximidamide;hydron;chloride.
Molecular Properties
| Compound Name | benzenecarboximidamide;hydron;chloride |
| PubChem CID | 66824376 |
| Molecular Formula | C7H9ClN2 |
| Molecular Weight | 156.62 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | benzenecarboximidamide;hydron;chloride |
| SMILES | [Cl-].[H+].[H]/N=C(\N)c1ccccc1 |
| InChI | InChI=1S/C7H8N2.ClH/c8-7(9)6-4-2-1-3-5-6;/h1-5H,(H3,8,9);1H |
| InChIKey | LZCZIHQBSCVGRD-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.62 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze benzenecarboximidamide;hydron;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenecarboximidamide;hydron;chloride?
The IUPAC name of benzenecarboximidamide;hydron;chloride (CID 66824376) is benzenecarboximidamide;hydron;chloride.
What is the SMILES notation for benzenecarboximidamide;hydron;chloride?
The canonical SMILES for benzenecarboximidamide;hydron;chloride is [Cl-].[H+].[H]/N=C(\N)c1ccccc1.
What is the InChIKey of benzenecarboximidamide;hydron;chloride?
The InChIKey is LZCZIHQBSCVGRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2.ClH/c8-7(9)6-4-2-1-3-5-6;/h1-5H,(H3,8,9);1H.
What are the key properties of benzenecarboximidamide;hydron;chloride?
benzenecarboximidamide;hydron;chloride has a molecular weight of 156.62 g/mol, XLogP of -1.91, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzenecarboximidamide;hydron;chloride is sourced from PubChem (CID 66824376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).