About trisodium;benzenecarboximidamide;phosphate
trisodium;benzenecarboximidamide;phosphate (PubChem CID 23196456) has the molecular formula C7H8N2Na3O4P
and a molecular weight of 284.09 g/mol. Its IUPAC name is trisodium;benzenecarboximidamide;phosphate.
Molecular Properties
| Compound Name | trisodium;benzenecarboximidamide;phosphate |
| PubChem CID | 23196456 |
| Molecular Formula | C7H8N2Na3O4P |
| Molecular Weight | 284.09 g/mol |
| Exact Mass | 283.99 |
| IUPAC Name | trisodium;benzenecarboximidamide;phosphate |
| SMILES | O=P([O-])([O-])[O-].[H]/N=C(\N)c1ccccc1.[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C7H8N2.3Na.H3O4P/c8-7(9)6-4-2-1-3-5-6;;;;1-5(2,3)4/h1-5H,(H3,8,9);;;;(H3,1,2,3,4)/q;3*+1;/p-3 |
| InChIKey | KNFMYSSYYFKXDE-UHFFFAOYSA-K |
| XLogP | -10.84 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.09 |
| LogP ≤ 5 | -10.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze trisodium;benzenecarboximidamide;phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trisodium;benzenecarboximidamide;phosphate?
The IUPAC name of trisodium;benzenecarboximidamide;phosphate (CID 23196456) is trisodium;benzenecarboximidamide;phosphate.
What is the SMILES notation for trisodium;benzenecarboximidamide;phosphate?
The canonical SMILES for trisodium;benzenecarboximidamide;phosphate is O=P([O-])([O-])[O-].[H]/N=C(\N)c1ccccc1.[Na+].[Na+].[Na+].
What is the InChIKey of trisodium;benzenecarboximidamide;phosphate?
The InChIKey is KNFMYSSYYFKXDE-UHFFFAOYSA-K. The full InChI is InChI=1S/C7H8N2.3Na.H3O4P/c8-7(9)6-4-2-1-3-5-6;;;;1-5(2,3)4/h1-5H,(H3,8,9);;;;(H3,1,2,3,4)/q;3*+1;/p-3.
What are the key properties of trisodium;benzenecarboximidamide;phosphate?
trisodium;benzenecarboximidamide;phosphate has a molecular weight of 284.09 g/mol, XLogP of -10.84, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for trisodium;benzenecarboximidamide;phosphate is sourced from PubChem (CID 23196456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).