C23H21N3O2 — CID 174325518
4-carbamimidoyl-N-(1-oxo-1,3-diphenylpropan-2-yl)benzamide (PubChem CID 174325518) has the molecular formula C23H21N3O2 and a molecular weight of 371.44 g/mol. Its IUPAC name is 4-carbamimidoyl-N-(1-oxo-1,3-diphenylpropan-2-yl)benzamide.
| Compound Name | 4-carbamimidoyl-N-(1-oxo-1,3-diphenylpropan-2-yl)benzamide |
|---|---|
| PubChem CID | 174325518 |
| Molecular Formula | C23H21N3O2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 4-carbamimidoyl-N-(1-oxo-1,3-diphenylpropan-2-yl)benzamide |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)NC(Cc2ccccc2)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H21N3O2/c24-22(25)18-11-13-19(14-12-18)23(28)26-20(15-16-7-3-1-4-8-16)21(27)17-9-5-2-6-10-17/h1-14,20H,15H2,(H3,24,25)(H,26,28) |
| InChIKey | QVQBMKRKGUDXOX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|