C18H17NO3 — CID 90679313
ethenyl (2S)-2-benzamido-3-phenylpropanoate (PubChem CID 90679313) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is ethenyl (2S)-2-benzamido-3-phenylpropanoate.
| Compound Name | ethenyl (2S)-2-benzamido-3-phenylpropanoate |
|---|---|
| PubChem CID | 90679313 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | ethenyl (2S)-2-benzamido-3-phenylpropanoate |
| SMILES | C=COC(=O)[C@H](Cc1ccccc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H17NO3/c1-2-22-18(21)16(13-14-9-5-3-6-10-14)19-17(20)15-11-7-4-8-12-15/h2-12,16H,1,13H2,(H,19,20)/t16-/m0/s1 |
| InChIKey | VBQMZCRMTUTMJL-INIZCTEOSA-N |
| XLogP | 2.71 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|