C31H32N4O2 — CID 20707956
4-(3-aminophenyl)-N-[3-[(3-carbamimidoylphenyl)methyl]-4-hydroxy-1-phenylbutan-2-yl]benzamide (PubChem CID 20707956) has the molecular formula C31H32N4O2 and a molecular weight of 492.62 g/mol. Its IUPAC name is 4-(3-aminophenyl)-N-[3-[(3-carbamimidoylphenyl)methyl]-4-hydroxy-1-phenylbutan-2-yl]benzamide.
| Compound Name | 4-(3-aminophenyl)-N-[3-[(3-carbamimidoylphenyl)methyl]-4-hydroxy-1-phenylbutan-2-yl]benzamide |
|---|---|
| PubChem CID | 20707956 |
| Molecular Formula | C31H32N4O2 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | 4-(3-aminophenyl)-N-[3-[(3-carbamimidoylphenyl)methyl]-4-hydroxy-1-phenylbutan-2-yl]benzamide |
| SMILES | [H]/N=C(\N)c1cccc(CC(CO)C(Cc2ccccc2)NC(=O)c2ccc(-c3cccc(N)c3)cc2)c1 |
| InChI | InChI=1S/C31H32N4O2/c32-28-11-5-9-25(19-28)23-12-14-24(15-13-23)31(37)35-29(18-21-6-2-1-3-7-21)27(20-36)17-22-8-4-10-26(16-22)30(33)34/h1-16,19,27,29,36H,17-18,20,32H2,(H3,33,34)(H,35,37) |
| InChIKey | YHPXLIYZWSORLX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 125.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|