C33H33N3O2 — CID 20708219
N-[(E)-4-[(3-carbamimidoylphenyl)methyl]-5-methoxy-1-phenylpent-1-en-3-yl]-4-phenylbenzamide (PubChem CID 20708219) has the molecular formula C33H33N3O2 and a molecular weight of 503.65 g/mol. Its IUPAC name is N-[(E)-4-[(3-carbamimidoylphenyl)methyl]-5-methoxy-1-phenylpent-1-en-3-yl]-4-phenylbenzamide.
| Compound Name | N-[(E)-4-[(3-carbamimidoylphenyl)methyl]-5-methoxy-1-phenylpent-1-en-3-yl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 20708219 |
| Molecular Formula | C33H33N3O2 |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.26 |
| IUPAC Name | N-[(E)-4-[(3-carbamimidoylphenyl)methyl]-5-methoxy-1-phenylpent-1-en-3-yl]-4-phenylbenzamide |
| SMILES | [H]/N=C(\N)c1cccc(CC(COC)C(/C=C/c2ccccc2)NC(=O)c2ccc(-c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C33H33N3O2/c1-38-23-30(22-25-11-8-14-29(21-25)32(34)35)31(20-15-24-9-4-2-5-10-24)36-33(37)28-18-16-27(17-19-28)26-12-6-3-7-13-26/h2-21,30-31H,22-23H2,1H3,(H3,34,35)(H,36,37)/b20-15+ |
| InChIKey | ZWTFULMWPLLWNJ-HMMYKYKNSA-N |
| XLogP | 5.95 |
| TPSA | 88.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|