C30H36N4O3 — CID 89134934
methyl 3-[(3-carbamimidoylphenyl)methyl]-4-[[4-[3-(methylaminomethyl)phenyl]benzoyl]amino]hexanoate (PubChem CID 89134934) has the molecular formula C30H36N4O3 and a molecular weight of 500.64 g/mol. Its IUPAC name is methyl 3-[(3-carbamimidoylphenyl)methyl]-4-[[4-[3-(methylaminomethyl)phenyl]benzoyl]amino]hexanoate.
| Compound Name | methyl 3-[(3-carbamimidoylphenyl)methyl]-4-[[4-[3-(methylaminomethyl)phenyl]benzoyl]amino]hexanoate |
|---|---|
| PubChem CID | 89134934 |
| Molecular Formula | C30H36N4O3 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.28 |
| IUPAC Name | methyl 3-[(3-carbamimidoylphenyl)methyl]-4-[[4-[3-(methylaminomethyl)phenyl]benzoyl]amino]hexanoate |
| SMILES | [H]/N=C(\N)c1cccc(CC(CC(=O)OC)C(CC)NC(=O)c2ccc(-c3cccc(CNC)c3)cc2)c1 |
| InChI | InChI=1S/C30H36N4O3/c1-4-27(26(18-28(35)37-3)16-20-7-5-10-25(15-20)29(31)32)34-30(36)23-13-11-22(12-14-23)24-9-6-8-21(17-24)19-33-2/h5-15,17,26-27,33H,4,16,18-19H2,1-3H3,(H3,31,32)(H,34,36) |
| InChIKey | OQJURZKRDWJLCU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 117.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|