C23H25N5O3 — CID 20708047
methyl 2-[(3-carbamimidoylphenyl)methyl]-3-[[4-(1H-imidazol-5-yl)benzoyl]amino]butanoate (PubChem CID 20708047) has the molecular formula C23H25N5O3 and a molecular weight of 419.49 g/mol. Its IUPAC name is methyl 2-[(3-carbamimidoylphenyl)methyl]-3-[[4-(1H-imidazol-5-yl)benzoyl]amino]butanoate.
| Compound Name | methyl 2-[(3-carbamimidoylphenyl)methyl]-3-[[4-(1H-imidazol-5-yl)benzoyl]amino]butanoate |
|---|---|
| PubChem CID | 20708047 |
| Molecular Formula | C23H25N5O3 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | methyl 2-[(3-carbamimidoylphenyl)methyl]-3-[[4-(1H-imidazol-5-yl)benzoyl]amino]butanoate |
| SMILES | [H]/N=C(\N)c1cccc(CC(C(=O)OC)C(C)NC(=O)c2ccc(-c3cnc[nH]3)cc2)c1 |
| InChI | InChI=1S/C23H25N5O3/c1-14(19(23(30)31-2)11-15-4-3-5-18(10-15)21(24)25)28-22(29)17-8-6-16(7-9-17)20-12-26-13-27-20/h3-10,12-14,19H,11H2,1-2H3,(H3,24,25)(H,26,27)(H,28,29) |
| InChIKey | ZUQNNGDCZDYLMV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 133.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|