C26H27N3O4 — CID 20708174
methyl 2-[(3-ethanimidoylphenyl)methyl]-3-[[4-(1-oxidopyridin-1-ium-3-yl)benzoyl]amino]butanoate (PubChem CID 20708174) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is methyl 2-[(3-ethanimidoylphenyl)methyl]-3-[[4-(1-oxidopyridin-1-ium-3-yl)benzoyl]amino]butanoate.
| Compound Name | methyl 2-[(3-ethanimidoylphenyl)methyl]-3-[[4-(1-oxidopyridin-1-ium-3-yl)benzoyl]amino]butanoate |
|---|---|
| PubChem CID | 20708174 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | methyl 2-[(3-ethanimidoylphenyl)methyl]-3-[[4-(1-oxidopyridin-1-ium-3-yl)benzoyl]amino]butanoate |
| SMILES | [H]/N=C(\C)c1cccc(CC(C(=O)OC)C(C)NC(=O)c2ccc(-c3ccc[n+]([O-])c3)cc2)c1 |
| InChI | InChI=1S/C26H27N3O4/c1-17(27)22-7-4-6-19(14-22)15-24(26(31)33-3)18(2)28-25(30)21-11-9-20(10-12-21)23-8-5-13-29(32)16-23/h4-14,16,18,24,27H,15H2,1-3H3,(H,28,30)/b27-17+ |
| InChIKey | SXOVNBNTZPOPEJ-WPWMEQJKSA-N |
| XLogP | 3.52 |
| TPSA | 106.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|