C27H26N2O3 — CID 20708209
methyl 3-(biphenylene-2-carbonylamino)-2-[(3-ethanimidoylphenyl)methyl]butanoate (PubChem CID 20708209) has the molecular formula C27H26N2O3 and a molecular weight of 426.52 g/mol. Its IUPAC name is methyl 3-(biphenylene-2-carbonylamino)-2-[(3-ethanimidoylphenyl)methyl]butanoate.
| Compound Name | methyl 3-(biphenylene-2-carbonylamino)-2-[(3-ethanimidoylphenyl)methyl]butanoate |
|---|---|
| PubChem CID | 20708209 |
| Molecular Formula | C27H26N2O3 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | methyl 3-(biphenylene-2-carbonylamino)-2-[(3-ethanimidoylphenyl)methyl]butanoate |
| SMILES | [H]/N=C(\C)c1cccc(CC(C(=O)OC)C(C)NC(=O)c2ccc3c(c2)-c2ccccc2-3)c1 |
| InChI | InChI=1S/C27H26N2O3/c1-16(28)19-8-6-7-18(13-19)14-24(27(31)32-3)17(2)29-26(30)20-11-12-23-21-9-4-5-10-22(21)25(23)15-20/h4-13,15,17,24,28H,14H2,1-3H3,(H,29,30)/b28-16+ |
| InChIKey | SFMWZOHOVOUINB-LQKURTRISA-N |
| XLogP | 4.87 |
| TPSA | 79.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|