C27H27N3O3 — CID 10530789
methyl (E,2S,3R)-3-benzamido-2-[(3-carbamimidoylphenyl)methyl]-5-phenylpent-4-enoate (PubChem CID 10530789) has the molecular formula C27H27N3O3 and a molecular weight of 441.53 g/mol. Its IUPAC name is methyl (E,2S,3R)-3-benzamido-2-[(3-carbamimidoylphenyl)methyl]-5-phenylpent-4-enoate.
| Compound Name | methyl (E,2S,3R)-3-benzamido-2-[(3-carbamimidoylphenyl)methyl]-5-phenylpent-4-enoate |
|---|---|
| PubChem CID | 10530789 |
| Molecular Formula | C27H27N3O3 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | methyl (E,2S,3R)-3-benzamido-2-[(3-carbamimidoylphenyl)methyl]-5-phenylpent-4-enoate |
| SMILES | [H]/N=C(\N)c1cccc(C[C@H](C(=O)OC)[C@@H](/C=C/c2ccccc2)NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C27H27N3O3/c1-33-27(32)23(18-20-11-8-14-22(17-20)25(28)29)24(16-15-19-9-4-2-5-10-19)30-26(31)21-12-6-3-7-13-21/h2-17,23-24H,18H2,1H3,(H3,28,29)(H,30,31)/b16-15+/t23-,24+/m0/s1 |
| InChIKey | ZMOPMAIWSBRIMS-PMZGJIOCSA-N |
| XLogP | 3.81 |
| TPSA | 105.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|