C26H22N2O3 — CID 20707966
(E)-3-benzamido-2-[(3-isocyanophenyl)methyl]-5-phenylpent-4-enoic acid (PubChem CID 20707966) has the molecular formula C26H22N2O3 and a molecular weight of 410.47 g/mol. Its IUPAC name is (E)-3-benzamido-2-[(3-isocyanophenyl)methyl]-5-phenylpent-4-enoic acid.
| Compound Name | (E)-3-benzamido-2-[(3-isocyanophenyl)methyl]-5-phenylpent-4-enoic acid |
|---|---|
| PubChem CID | 20707966 |
| Molecular Formula | C26H22N2O3 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | (E)-3-benzamido-2-[(3-isocyanophenyl)methyl]-5-phenylpent-4-enoic acid |
| SMILES | [C-]#[N+]c1cccc(CC(C(=O)O)C(/C=C/c2ccccc2)NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C26H22N2O3/c1-27-22-14-8-11-20(17-22)18-23(26(30)31)24(16-15-19-9-4-2-5-10-19)28-25(29)21-12-6-3-7-13-21/h2-17,23-24H,18H2,(H,28,29)(H,30,31)/b16-15+ |
| InChIKey | KCTHHEYQMINZSU-FOCLMDBBSA-N |
| XLogP | 4.99 |
| TPSA | 70.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|