C18H19NO2 — CID 143394001
2-(methylamino)-3-[3-[(Z)-2-phenylethenyl]phenyl]propanoic acid (PubChem CID 143394001) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-(methylamino)-3-[3-[(Z)-2-phenylethenyl]phenyl]propanoic acid.
| Compound Name | 2-(methylamino)-3-[3-[(Z)-2-phenylethenyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 143394001 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 2-(methylamino)-3-[3-[(Z)-2-phenylethenyl]phenyl]propanoic acid |
| SMILES | CNC(Cc1cccc(/C=C\c2ccccc2)c1)C(=O)O |
| InChI | InChI=1S/C18H19NO2/c1-19-17(18(20)21)13-16-9-5-8-15(12-16)11-10-14-6-3-2-4-7-14/h2-12,17,19H,13H2,1H3,(H,20,21)/b11-10- |
| InChIKey | IVFIDFQXKQINIF-KHPPLWFESA-N |
| XLogP | 3.07 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|