C35H36 — CID 146834185
1-[3,3-dimethyl-2-[[3-[(E)-2-phenylethenyl]phenyl]methyl]butyl]-3-[(E)-2-phenylethenyl]benzene (PubChem CID 146834185) has the molecular formula C35H36 and a molecular weight of 456.67 g/mol. Its IUPAC name is 1-[3,3-dimethyl-2-[[3-[(E)-2-phenylethenyl]phenyl]methyl]butyl]-3-[(E)-2-phenylethenyl]benzene.
| Compound Name | 1-[3,3-dimethyl-2-[[3-[(E)-2-phenylethenyl]phenyl]methyl]butyl]-3-[(E)-2-phenylethenyl]benzene |
|---|---|
| PubChem CID | 146834185 |
| Molecular Formula | C35H36 |
| Molecular Weight | 456.67 g/mol |
| Exact Mass | 456.28 |
| IUPAC Name | 1-[3,3-dimethyl-2-[[3-[(E)-2-phenylethenyl]phenyl]methyl]butyl]-3-[(E)-2-phenylethenyl]benzene |
| SMILES | CC(C)(C)C(Cc1cccc(/C=C/c2ccccc2)c1)Cc1cccc(/C=C/c2ccccc2)c1 |
| InChI | InChI=1S/C35H36/c1-35(2,3)34(26-32-18-10-16-30(24-32)22-20-28-12-6-4-7-13-28)27-33-19-11-17-31(25-33)23-21-29-14-8-5-9-15-29/h4-25,34H,26-27H2,1-3H3/b22-20+,23-21+ |
| InChIKey | SEUGJXCQDCSALZ-DQPVQCHKSA-N |
| XLogP | 9.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.67 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|