C22H23NO — CID 139920537
N,N-dimethyl-1-[5-[[3-[(E)-2-phenylethenyl]phenyl]methyl]furan-2-yl]methanamine (PubChem CID 139920537) has the molecular formula C22H23NO and a molecular weight of 317.43 g/mol. Its IUPAC name is N,N-dimethyl-1-[5-[[3-[(E)-2-phenylethenyl]phenyl]methyl]furan-2-yl]methanamine.
| Compound Name | N,N-dimethyl-1-[5-[[3-[(E)-2-phenylethenyl]phenyl]methyl]furan-2-yl]methanamine |
|---|---|
| PubChem CID | 139920537 |
| Molecular Formula | C22H23NO |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | N,N-dimethyl-1-[5-[[3-[(E)-2-phenylethenyl]phenyl]methyl]furan-2-yl]methanamine |
| SMILES | CN(C)Cc1ccc(Cc2cccc(/C=C/c3ccccc3)c2)o1 |
| InChI | InChI=1S/C22H23NO/c1-23(2)17-22-14-13-21(24-22)16-20-10-6-9-19(15-20)12-11-18-7-4-3-5-8-18/h3-15H,16-17H2,1-2H3/b12-11+ |
| InChIKey | XTXRYIPDTJVTHX-VAWYXSNFSA-N |
| XLogP | 5.10 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|