C23H30O2 — CID 23439737
3-[(E)-2-[3-(7-hydroxy-7-methyloctyl)phenyl]ethenyl]phenol (PubChem CID 23439737) has the molecular formula C23H30O2 and a molecular weight of 338.49 g/mol. Its IUPAC name is 3-[(E)-2-[3-(7-hydroxy-7-methyloctyl)phenyl]ethenyl]phenol.
| Compound Name | 3-[(E)-2-[3-(7-hydroxy-7-methyloctyl)phenyl]ethenyl]phenol |
|---|---|
| PubChem CID | 23439737 |
| Molecular Formula | C23H30O2 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | 3-[(E)-2-[3-(7-hydroxy-7-methyloctyl)phenyl]ethenyl]phenol |
| SMILES | CC(C)(O)CCCCCCc1cccc(/C=C/c2cccc(O)c2)c1 |
| InChI | InChI=1S/C23H30O2/c1-23(2,25)16-6-4-3-5-9-19-10-7-11-20(17-19)14-15-21-12-8-13-22(24)18-21/h7-8,10-15,17-18,24-25H,3-6,9,16H2,1-2H3/b15-14+ |
| InChIKey | CTCBJIKWJPZIID-CCEZHUSRSA-N |
| XLogP | 5.83 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|