C23H30O3 — CID 57272502
5-[2-[3-(6-hydroxy-7-methyloctyl)phenyl]ethenyl]benzene-1,3-diol (PubChem CID 57272502) has the molecular formula C23H30O3 and a molecular weight of 354.49 g/mol. Its IUPAC name is 5-[2-[3-(6-hydroxy-7-methyloctyl)phenyl]ethenyl]benzene-1,3-diol.
| Compound Name | 5-[2-[3-(6-hydroxy-7-methyloctyl)phenyl]ethenyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 57272502 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 5-[2-[3-(6-hydroxy-7-methyloctyl)phenyl]ethenyl]benzene-1,3-diol |
| SMILES | CC(C)C(O)CCCCCc1cccc(C=Cc2cc(O)cc(O)c2)c1 |
| InChI | InChI=1S/C23H30O3/c1-17(2)23(26)10-5-3-4-7-18-8-6-9-19(13-18)11-12-20-14-21(24)16-22(25)15-20/h6,8-9,11-17,23-26H,3-5,7,10H2,1-2H3 |
| InChIKey | CQFSZZJTRREKMM-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|