C26H36O5 — CID 57095837
6-[3-[2-[3,5-bis(ethoxymethoxy)phenyl]ethenyl]phenyl]hexan-1-ol (PubChem CID 57095837) has the molecular formula C26H36O5 and a molecular weight of 428.57 g/mol. Its IUPAC name is 6-[3-[2-[3,5-bis(ethoxymethoxy)phenyl]ethenyl]phenyl]hexan-1-ol.
| Compound Name | 6-[3-[2-[3,5-bis(ethoxymethoxy)phenyl]ethenyl]phenyl]hexan-1-ol |
|---|---|
| PubChem CID | 57095837 |
| Molecular Formula | C26H36O5 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | 6-[3-[2-[3,5-bis(ethoxymethoxy)phenyl]ethenyl]phenyl]hexan-1-ol |
| SMILES | CCOCOc1cc(C=Cc2cccc(CCCCCCO)c2)cc(OCOCC)c1 |
| InChI | InChI=1S/C26H36O5/c1-3-28-20-30-25-17-24(18-26(19-25)31-21-29-4-2)14-13-23-12-9-11-22(16-23)10-7-5-6-8-15-27/h9,11-14,16-19,27H,3-8,10,15,20-21H2,1-2H3 |
| InChIKey | BWGGUQGWFMXTTD-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|