C28H38O5 — CID 57101221
7-[3-[2-[3,5-bis(ethoxymethoxy)phenyl]ethenyl]phenyl]-2-methylhept-6-en-3-ol (PubChem CID 57101221) has the molecular formula C28H38O5 and a molecular weight of 454.61 g/mol. Its IUPAC name is 7-[3-[2-[3,5-bis(ethoxymethoxy)phenyl]ethenyl]phenyl]-2-methylhept-6-en-3-ol.
| Compound Name | 7-[3-[2-[3,5-bis(ethoxymethoxy)phenyl]ethenyl]phenyl]-2-methylhept-6-en-3-ol |
|---|---|
| PubChem CID | 57101221 |
| Molecular Formula | C28H38O5 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | 7-[3-[2-[3,5-bis(ethoxymethoxy)phenyl]ethenyl]phenyl]-2-methylhept-6-en-3-ol |
| SMILES | CCOCOc1cc(C=Cc2cccc(C=CCCC(O)C(C)C)c2)cc(OCOCC)c1 |
| InChI | InChI=1S/C28H38O5/c1-5-30-20-32-26-17-25(18-27(19-26)33-21-31-6-2)15-14-24-12-9-11-23(16-24)10-7-8-13-28(29)22(3)4/h7,9-12,14-19,22,28-29H,5-6,8,13,20-21H2,1-4H3 |
| InChIKey | HZWODCVOAZPSON-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|