6-[3-(methoxymethoxy)phenyl]hex-5-enoic acid

C14H18O4 — CID 139922099

IUPAC6-[3-(methoxymethoxy)phenyl]hex-5-enoic acid
SMILESCOCOc1cccc(C=CCCCC(=O)O)c1
InChIInChI=1S/C14H18O4/c1-17-11-18-13-8-5-7-12(10-13)6-3-2-4-9-14(15)16/h3,5-8,10H,2,4,9,11H2,1H3,(H,15,16)
InChIKeyYWJLTEVDOIGKEX-UHFFFAOYSA-N
MW250.29 g/mol
LogP2.94
Rot. Bonds8

About 6-[3-(methoxymethoxy)phenyl]hex-5-enoic acid

6-[3-(methoxymethoxy)phenyl]hex-5-enoic acid (PubChem CID 139922099) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is 6-[3-(methoxymethoxy)phenyl]hex-5-enoic acid.

Molecular Properties

Compound Name6-[3-(methoxymethoxy)phenyl]hex-5-enoic acid
PubChem CID139922099
Molecular FormulaC14H18O4
Molecular Weight250.29 g/mol
Exact Mass250.12
IUPAC Name6-[3-(methoxymethoxy)phenyl]hex-5-enoic acid
SMILESCOCOc1cccc(C=CCCCC(=O)O)c1
InChIInChI=1S/C14H18O4/c1-17-11-18-13-8-5-7-12(10-13)6-3-2-4-9-14(15)16/h3,5-8,10H,2,4,9,11H2,1H3,(H,15,16)
InChIKeyYWJLTEVDOIGKEX-UHFFFAOYSA-N
XLogP2.94
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.29
LogP ≤ 52.94
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze 6-[3-(methoxymethoxy)phenyl]hex-5-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

10-(3-fluorophenyl)dec-9-enoic acid
CID 66874108
1-(2,2-dichloroethenyl)-3-(methoxymethoxy)benzene
CID 138987762
(E)-6-(3-fluoro-4-methoxyphenyl)hex-5-enoic acid
CID 95453750
(E)-6-(3-methoxyphenyl)hex-5-en-1-ol
CID 14739737
7-phenylhept-6-en-2-one
CID 582607
(E)-7-(3-benzylphenyl)hept-6-enoic acid
CID 18987223
4-[3-(3-ethoxyphenyl)prop-2-enoylamino]butanoic acid
CID 131846324
(E)-4-(3-phenylmethoxyphenyl)but-3-enoic acid
CID 102534265
S-[4-(3-methoxyphenyl)but-3-enyl] ethanethioate
CID 170479718
5-(3-chlorophenyl)pent-4-enoic acid
CID 72993428
(E)-6-(4-tert-butylphenyl)hex-5-enoic acid
CID 95457618
1,5-bis(3-butoxyphenyl)penta-1,4-dien-3-one
CID 77385934

Frequently Asked Questions

What is the IUPAC name of 6-[3-(methoxymethoxy)phenyl]hex-5-enoic acid?
The IUPAC name of 6-[3-(methoxymethoxy)phenyl]hex-5-enoic acid (CID 139922099) is 6-[3-(methoxymethoxy)phenyl]hex-5-enoic acid.
What is the SMILES notation for 6-[3-(methoxymethoxy)phenyl]hex-5-enoic acid?
The canonical SMILES for 6-[3-(methoxymethoxy)phenyl]hex-5-enoic acid is COCOc1cccc(C=CCCCC(=O)O)c1.
What is the InChIKey of 6-[3-(methoxymethoxy)phenyl]hex-5-enoic acid?
The InChIKey is YWJLTEVDOIGKEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O4/c1-17-11-18-13-8-5-7-12(10-13)6-3-2-4-9-14(15)16/h3,5-8,10H,2,4,9,11H2,1H3,(H,15,16).
What are the key properties of 6-[3-(methoxymethoxy)phenyl]hex-5-enoic acid?
6-[3-(methoxymethoxy)phenyl]hex-5-enoic acid has a molecular weight of 250.29 g/mol, XLogP of 2.94, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-(methoxymethoxy)phenyl]hex-5-enoic acid is sourced from PubChem (CID 139922099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).