C10H10Cl2O2 — CID 138987762
1-(2,2-dichloroethenyl)-3-(methoxymethoxy)benzene (PubChem CID 138987762) has the molecular formula C10H10Cl2O2 and a molecular weight of 233.09 g/mol. Its IUPAC name is 1-(2,2-dichloroethenyl)-3-(methoxymethoxy)benzene.
| Compound Name | 1-(2,2-dichloroethenyl)-3-(methoxymethoxy)benzene |
|---|---|
| PubChem CID | 138987762 |
| Molecular Formula | C10H10Cl2O2 |
| Molecular Weight | 233.09 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | 1-(2,2-dichloroethenyl)-3-(methoxymethoxy)benzene |
| SMILES | COCOc1cccc(C=C(Cl)Cl)c1 |
| InChI | InChI=1S/C10H10Cl2O2/c1-13-7-14-9-4-2-3-8(5-9)6-10(11)12/h2-6H,7H2,1H3 |
| InChIKey | GBTCRNDKEUYKDK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.09 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|