C14H22ClN3O3 — CID 11483897
[2-[(2E)-2-[[3-(methoxymethoxy)phenyl]methylidene]hydrazinyl]-2-oxoethyl]-trimethylazanium chloride (PubChem CID 11483897) has the molecular formula C14H22ClN3O3 and a molecular weight of 315.80 g/mol. Its IUPAC name is [2-[(2E)-2-[[3-(methoxymethoxy)phenyl]methylidene]hydrazinyl]-2-oxoethyl]-trimethylazanium chloride.
| Compound Name | [2-[(2E)-2-[[3-(methoxymethoxy)phenyl]methylidene]hydrazinyl]-2-oxoethyl]-trimethylazanium chloride |
|---|---|
| PubChem CID | 11483897 |
| Molecular Formula | C14H22ClN3O3 |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | [2-[(2E)-2-[[3-(methoxymethoxy)phenyl]methylidene]hydrazinyl]-2-oxoethyl]-trimethylazanium chloride |
| SMILES | COCOc1cccc(/C=N/NC(=O)C[N+](C)(C)C)c1.[Cl-] |
| InChI | InChI=1S/C14H21N3O3.ClH/c1-17(2,3)10-14(18)16-15-9-12-6-5-7-13(8-12)20-11-19-4;/h5-9H,10-11H2,1-4H3;1H/b15-9+; |
| InChIKey | RTRCMLIWUYMDJJ-NSPIFIKESA-N |
| XLogP | -2.17 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|