C12H18N3O4S+ — CID 5474238
trimethyl-[2-oxo-2-[(2Z)-2-[(3-sulfophenyl)methylidene]hydrazinyl]ethyl]azanium (PubChem CID 5474238) has the molecular formula C12H18N3O4S+ and a molecular weight of 300.36 g/mol. Its IUPAC name is trimethyl-[2-oxo-2-[(2Z)-2-[(3-sulfophenyl)methylidene]hydrazinyl]ethyl]azanium.
| Compound Name | trimethyl-[2-oxo-2-[(2Z)-2-[(3-sulfophenyl)methylidene]hydrazinyl]ethyl]azanium |
|---|---|
| PubChem CID | 5474238 |
| Molecular Formula | C12H18N3O4S+ |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | trimethyl-[2-oxo-2-[(2Z)-2-[(3-sulfophenyl)methylidene]hydrazinyl]ethyl]azanium |
| SMILES | C[N+](C)(C)CC(=O)N/N=C\c1cccc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C12H17N3O4S/c1-15(2,3)9-12(16)14-13-8-10-5-4-6-11(7-10)20(17,18)19/h4-8H,9H2,1-3H3,(H-,14,16,17,18,19)/p+1/b13-8- |
| InChIKey | QNHVKBQTUCEFHH-JYRVWZFOSA-O |
| XLogP | 0.09 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|