C12H17FN3O+ — CID 117060553
[2-[(2E)-2-[(2-fluorophenyl)methylidene]hydrazinyl]-2-oxoethyl]-trimethylazanium (PubChem CID 117060553) has the molecular formula C12H17FN3O+ and a molecular weight of 238.29 g/mol. Its IUPAC name is [2-[(2E)-2-[(2-fluorophenyl)methylidene]hydrazinyl]-2-oxoethyl]-trimethylazanium.
| Compound Name | [2-[(2E)-2-[(2-fluorophenyl)methylidene]hydrazinyl]-2-oxoethyl]-trimethylazanium |
|---|---|
| PubChem CID | 117060553 |
| Molecular Formula | C12H17FN3O+ |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | [2-[(2E)-2-[(2-fluorophenyl)methylidene]hydrazinyl]-2-oxoethyl]-trimethylazanium |
| SMILES | C[N+](C)(C)CC(=O)N/N=C/c1ccccc1F |
| InChI | InChI=1S/C12H16FN3O/c1-16(2,3)9-12(17)15-14-8-10-6-4-5-7-11(10)13/h4-8H,9H2,1-3H3/p+1/b14-8+ |
| InChIKey | BFUZTJRPSWVGJP-RIYZIHGNSA-O |
| XLogP | 0.98 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|